CAS 79379-93-4 is the registry number for Dimethyl 3-benzoylisoxazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Dimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate (CAS 79379-93-4) is a chemical compound with the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. IUPAC name: dimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate. InChIKey: RZMXOUNJYAZJTQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO6 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | dimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate |
| InChIKey | RZMXOUNJYAZJTQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(ON=C1C(=O)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)