Products 79379-93-4

CAS 79379-93-4 is the registry number for Dimethyl 3-benzoylisoxazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate (CAS 79379-93-4) is a chemical compound with the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. IUPAC name: dimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate. InChIKey: RZMXOUNJYAZJTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO6
Molecular weight289.24 g/mol
IUPAC namedimethyl 3-benzoyl-1,2-oxazole-4,5-dicarboxylate
InChIKeyRZMXOUNJYAZJTQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(ON=C1C(=O)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)