CAS 623583-08-4 appears in our catalog under these names: ((2S,4S)–4–Fluoropyrrolidin–2–yl)methanol hydrochloride, 2S,4S)-4-Fluoropyrrolidin-2-Yl)Methanol Hydrochloride, ((2S,4S)-4-Fluoropyrrolidin-2-yl)methanol hydrochloride, 97%, ((2S,4S)-4-Fluoropyrrolidin-2-yl)methanol hydrochloride, 92%, ((2S,4S)-4-FLUOROPYRROLIDIN-2-YL)METHANOL HCL, 97%, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 0,5g, 5g, 10g, 1g, 25g, 500mg.
[(2S,4S)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride (CAS 623583-08-4) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: [(2S,4S)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride. InChIKey: MCSMAEKVMQAPIQ-FHAQVOQBSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | [(2S,4S)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride |
| InChIKey | MCSMAEKVMQAPIQ-FHAQVOQBSA-N |
| SMILES | C1[C@@H](CN[C@@H]1CO)F.Cl |
Computed by PubChem (NCBI)