CAS 1147112-69-3 appears in our catalog under these names: (3S,4R)-3-Fluoropiperidin-4-ol, 98+%, (3S,4R)-3-Fluoropiperidin-4-ol hydrochloride, 95%, (3S,4R)-3-FLUORO-4-PIPERIDINOL HCL, 97%. Offered by: AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3S,4R)-3-fluoropiperidin-4-ol;hydrochloride (CAS 1147112-69-3) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride. InChIKey: VGRYZBPWUNRGDD-UYXJWNHNSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride |
| InChIKey | VGRYZBPWUNRGDD-UYXJWNHNSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1O)F.Cl |
Computed by PubChem (NCBI)