CAS 62390-94-7 is the registry number for Ethyl 5-amino-3-methanesulfonyl-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate (CAS 62390-94-7) is a chemical compound with the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. IUPAC name: ethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate. InChIKey: RGRFQWBMZWTTGH-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4S |
|---|---|
| Molecular weight | 233.25 g/mol |
| IUPAC name | ethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate |
| InChIKey | RGRFQWBMZWTTGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NN=C1N)S(=O)(=O)C |
Computed by PubChem (NCBI)