Products 62390-94-7

CAS 62390-94-7 is the registry number for Ethyl 5-amino-3-methanesulfonyl-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate (CAS 62390-94-7) is a chemical compound with the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. IUPAC name: ethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate. InChIKey: RGRFQWBMZWTTGH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11N3O4S
Molecular weight233.25 g/mol
IUPAC nameethyl 3-amino-5-methylsulfonyl-1H-pyrazole-4-carboxylate
InChIKeyRGRFQWBMZWTTGH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NN=C1N)S(=O)(=O)C

Computed by PubChem (NCBI)