CAS 88398-81-6 appears in our catalog under these names: 1-Methyl-4-ethyl formate-5-pyrazole sulfonamide, 98%, 4–Ethyl–1H–pyrazole–5–sulfonamide Acetate, Ethyl 1-methyl-5-sulfamoylpyrazole-4-carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 10mg, 2g.
Ethyl 1-methyl-5-sulfamoylpyrazole-4-carboxylate (CAS 88398-81-6) is a chemical compound with the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. IUPAC name: ethyl 1-methyl-5-sulfamoylpyrazole-4-carboxylate. InChIKey: ICDLJCWXRUNUNO-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4S |
|---|---|
| Molecular weight | 233.25 g/mol |
| IUPAC name | ethyl 1-methyl-5-sulfamoylpyrazole-4-carboxylate |
| InChIKey | ICDLJCWXRUNUNO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C)S(=O)(=O)N |
Computed by PubChem (NCBI)