Products 62499-70-1
CAS 62499-70-1 appears in our catalog under these names: Isofutoquinol A, Isofutoquinol A, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 5mg.
(2R,6S,7S,8R)-7-(1,3-benzodioxol-5-yl)-2,3-dimethoxy-8-methyl-6-prop-2-enyltricyclo[4.2.0.02,8]oct-3-en-5-one (CAS 62499-70-1) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (2R,6S,7S,8R)-7-(1,3-benzodioxol-5-yl)-2,3-dimethoxy-8-methyl-6-prop-2-enyltricyclo[4.2.0.02,8]oct-3-en-5-one. InChIKey: LYOBQEYDVDTMSQ-ZQEFZMAUSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R,6S,7S,8R)-7-(1,3-benzodioxol-5-yl)-2,3-dimethoxy-8-methyl-6-prop-2-enyltricyclo[4.2.0.02,8]oct-3-en-5-one |
| InChIKey | LYOBQEYDVDTMSQ-ZQEFZMAUSA-N |
| SMILES | C[C@@]12[C@@H]([C@]3(C1[C@@]2(C(=CC3=O)OC)OC)CC=C)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)
Synonyms:
isofutoquinol A