Products 62501-73-9
CAS 62501-73-9 is the registry number for (S)-(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (CAS 62501-73-9) is a chemical compound with the molecular formula C16H16O5S and a molecular weight of 320.4 g/mol. IUPAC name: [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate. InChIKey: OTGAYUCEDFKLHW-ZDUSSCGKSA-N.
| Molecular formula | C16H16O5S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | OTGAYUCEDFKLHW-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2COC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)