Products 66338-52-1
CAS 66338-52-1 is the registry number for Toluene-4-sulfonic acid 4-acetyl-2-methoxy-phenyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(4-acetyl-2-methoxyphenyl) 4-methylbenzenesulfonate (CAS 66338-52-1) is a chemical compound with the molecular formula C16H16O5S and a molecular weight of 320.4 g/mol. IUPAC name: (4-acetyl-2-methoxyphenyl) 4-methylbenzenesulfonate. InChIKey: DLFOLRWDLRMDPY-UHFFFAOYSA-N.
| Molecular formula | C16H16O5S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (4-acetyl-2-methoxyphenyl) 4-methylbenzenesulfonate |
| InChIKey | DLFOLRWDLRMDPY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)C(=O)C)OC |
Computed by PubChem (NCBI)