Products 864659-19-8

CAS 864659-19-8 is the registry number for 2-Methoxyoxazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxy-1,3-oxazole-5-carboxylic acid (CAS 864659-19-8) is a chemical compound with the molecular formula C5H5NO4 and a molecular weight of 143.10 g/mol. IUPAC name: 2-methoxy-1,3-oxazole-5-carboxylic acid. InChIKey: HWRVZXDPEUUZOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO4
Molecular weight143.10 g/mol
IUPAC name2-methoxy-1,3-oxazole-5-carboxylic acid
InChIKeyHWRVZXDPEUUZOZ-UHFFFAOYSA-N
SMILESCOC1=NC=C(O1)C(=O)O

Computed by PubChem (NCBI)