CAS 62510-46-7 appears in our catalog under these names: Mianserin N-Oxide, >95% (HPLC), Mianserin N-Oxide, Mianserin N-oxide, min. 95 %, 1 mg, Mianserin N-oxide, min. 95 %, 2 mg, Mianserin N-oxide, min. 95 %, 5 mg. Offered by: TRC, Mikromol, LoGiCal, Biosynth, Roth. Available pack sizes: 5mg, 100mg, 10mg, 2mg, 1mg, 25mg.
5-methyl-5-oxido-2-aza-5-azoniatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (CAS 62510-46-7) is a chemical compound with the molecular formula C18H20N2O and a molecular weight of 280.4 g/mol. IUPAC name: 5-methyl-5-oxido-2-aza-5-azoniatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene. InChIKey: VVDXWJOYXVNLLQ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 5-methyl-5-oxido-2-aza-5-azoniatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| InChIKey | VVDXWJOYXVNLLQ-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCN2C(C1)C3=CC=CC=C3CC4=CC=CC=C42)[O-] |
Computed by PubChem (NCBI)