CAS 62564-91-4 is the registry number for 5-Amino-1-phenyl-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 2g.
5-amino-1-phenylpyrazole-4-carbaldehyde (CAS 62564-91-4) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 5-amino-1-phenylpyrazole-4-carbaldehyde. InChIKey: MTPJWTSHVKOZNW-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 5-amino-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | MTPJWTSHVKOZNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C=N2)C=O)N |
Computed by PubChem (NCBI)