CAS 6260-97-5 is the registry number for (4-Chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.
(4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone (CAS 6260-97-5) is a chemical compound with the molecular formula C17H14ClNO2 and a molecular weight of 299.7 g/mol. IUPAC name: (4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone. InChIKey: POZBHYDICLJVKQ-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO2 |
|---|---|
| Molecular weight | 299.7 g/mol |
| IUPAC name | (4-chlorophenyl)-(5-methoxy-2-methylindol-1-yl)methanone |
| InChIKey | POZBHYDICLJVKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC |
Computed by PubChem (NCBI)