CAS 62625-24-5 appears in our catalog under these names: 4-Phenylazophenacyl bromide, 95%, 4–Phenylazophenacyl Bromide, 4-Phenylazophenacyl Bromide, >98.0%(T), 4-Phenylazophenacyl Bromide, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg.
2-bromo-1-(4-phenyldiazenylphenyl)ethanone (CAS 62625-24-5) is a chemical compound with the molecular formula C14H11BrN2O and a molecular weight of 303.15 g/mol. IUPAC name: 2-bromo-1-(4-phenyldiazenylphenyl)ethanone. InChIKey: ZXTGCMLCYPYCID-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | 2-bromo-1-(4-phenyldiazenylphenyl)ethanone |
| InChIKey | ZXTGCMLCYPYCID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)