CAS 850363-66-5 is the registry number for 1H-Indazole,5-bromo-4-(phenylmethoxy)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-4-phenylmethoxy-1H-indazole (CAS 850363-66-5) is a chemical compound with the molecular formula C14H11BrN2O and a molecular weight of 303.15 g/mol. IUPAC name: 5-bromo-4-phenylmethoxy-1H-indazole. InChIKey: BMLQCJLQVVXXLD-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | 5-bromo-4-phenylmethoxy-1H-indazole |
| InChIKey | BMLQCJLQVVXXLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC3=C2C=NN3)Br |
Computed by PubChem (NCBI)