CAS 6266-56-4 is the registry number for Phenyldi-p-tolylmethanol, 98%. Offered by: AmBeed. Available pack sizes: 25g.
Bis(4-methylphenyl)-phenylmethanol (CAS 6266-56-4) is a chemical compound with the molecular formula C21H20O and a molecular weight of 288.4 g/mol. IUPAC name: bis(4-methylphenyl)-phenylmethanol. InChIKey: YERSCBIKMYKKHA-UHFFFAOYSA-N.
| Molecular formula | C21H20O |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | bis(4-methylphenyl)-phenylmethanol |
| InChIKey | YERSCBIKMYKKHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)C)O |
Computed by PubChem (NCBI)