CAS 62756-19-8 appears in our catalog under these names: Spiro(chroman-2,1'-cyclopentan)-4-one, 98%, 3,4-Dihydrospiro(1-benzopyran-2,1'-cyclopentane)-4-one, Spiro[chroman-2,1'-cyclopentan]-4-one, 98%, 98%, 3,4-Dihydrospiro[1-benzopyran-2,1'-cyclopentane]-4-one, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
Spiro[3H-chromene-2,1'-cyclopentane]-4-one (CAS 62756-19-8) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: spiro[3H-chromene-2,1'-cyclopentane]-4-one. InChIKey: ICHMJHUCIOLELS-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | spiro[3H-chromene-2,1'-cyclopentane]-4-one |
| InChIKey | ICHMJHUCIOLELS-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)