Products 62770-67-6
CAS 62770-67-6 is the registry number for Clausarin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one (CAS 62770-67-6) is a chemical compound with the molecular formula C24H28O4 and a molecular weight of 380.5 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one. InChIKey: LMEKIDFKWUPZGE-UHFFFAOYSA-N.
| Molecular formula | C24H28O4 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)pyrano[3,2-g]chromen-8-one |
| InChIKey | LMEKIDFKWUPZGE-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=C3C(=C2O)C=C(C(=O)O3)C(C)(C)C=C)C(C)(C)C=C)C |
Computed by PubChem (NCBI)