Products 627835-17-0
CAS 627835-17-0 is the registry number for 1-(3-acetylphenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3-acetylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 627835-17-0) is a chemical compound with the molecular formula C19H21NO2 and a molecular weight of 295.4 g/mol. IUPAC name: 1-(3-acetylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: OWCQIMLXOAWKNF-UHFFFAOYSA-N.
| Molecular formula | C19H21NO2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 1-(3-acetylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | OWCQIMLXOAWKNF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=CC(=C3)C(=O)C)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)