CAS 627906-50-7 is the registry number for 4-(3-Methoxycarbonylphenyl)-2-methylphenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-(4-hydroxy-3-methylphenyl)benzoate (CAS 627906-50-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 3-(4-hydroxy-3-methylphenyl)benzoate. InChIKey: UWGVZGKYHWFZON-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 3-(4-hydroxy-3-methylphenyl)benzoate |
| InChIKey | UWGVZGKYHWFZON-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=CC=C2)C(=O)OC)O |
Computed by PubChem (NCBI)