CAS 627906-96-1 appears in our catalog under these names: 5,5-Dimethyl-2-(2-naphthalenyl)-1,3,2-dioxaborinane, 95-<97%, 5,5-Dimethyl-2-(2-naphthalenyl)-1,3,2-dioxaborinane, ≥97-<99%, 5,5–Dimethyl–2–(naphthalen–2–yl)–1,3,2–dioxaborinane, 5,5-Dimethyl-2-(naphthalen-2-yl)-1,3,2-dioxaborinane, 97%, 97%, 5,5-Dimethyl-2-(naphthalen-2-yl)-1,3,2-dioxaborinane, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g, 1g, 5g.
5,5-dimethyl-2-naphthalen-2-yl-1,3,2-dioxaborinane (CAS 627906-96-1) is a chemical compound with the molecular formula C15H17BO2 and a molecular weight of 240.11 g/mol. IUPAC name: 5,5-dimethyl-2-naphthalen-2-yl-1,3,2-dioxaborinane. InChIKey: PYUGEXFBFIGNIR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO2 |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 5,5-dimethyl-2-naphthalen-2-yl-1,3,2-dioxaborinane |
| InChIKey | PYUGEXFBFIGNIR-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)