CAS 153035-56-4 appears in our catalog under these names: 4'-Propyl-4-biphenylboronic Acid, 98%, 98%, (4'-Propyl-[1,1'-biphenyl]-4-yl)boronic acid, 98%, 4'-Propyl-4-biphenylboronic Acid (contains varying amounts of Anhydride). Offered by: Chemat, Fluorochem, Ambeed, TCI. Available pack sizes: 1g, 5g, 25g, 100g.
[4-(4-propylphenyl)phenyl]boronic acid (CAS 153035-56-4) is a chemical compound with the molecular formula C15H17BO2 and a molecular weight of 240.11 g/mol. IUPAC name: [4-(4-propylphenyl)phenyl]boronic acid. InChIKey: NOQFUISBLHCDSR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO2 |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | [4-(4-propylphenyl)phenyl]boronic acid |
| InChIKey | NOQFUISBLHCDSR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CCC)(O)O |
Computed by PubChem (NCBI)