Products 628692-17-1
CAS 628692-17-1 appears in our catalog under these names: Benzo[b]thiophen-7-ylboronic acid 97%, Benzo[b]thiophen-7-ylboronic acid, 97%, 97%, 7-Benzothiopheneboronic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1-benzothiophen-7-ylboronic acid (CAS 628692-17-1) is a chemical compound with the molecular formula C8H7BO2S and a molecular weight of 178.02 g/mol. IUPAC name: 1-benzothiophen-7-ylboronic acid. InChIKey: RVFILKCRCVFHPV-UHFFFAOYSA-N.
| Molecular formula | C8H7BO2S |
|---|---|
| Molecular weight | 178.02 g/mol |
| IUPAC name | 1-benzothiophen-7-ylboronic acid |
| InChIKey | RVFILKCRCVFHPV-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CS2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Benzothien-7-ylboronic acid, Benzo[b]thiophen-7-ylboronic acid, 1-benzothiophen-7-ylboronic acid, benzothiophen-7-ylboronic acid, 7-Benzothiopheneboronic acid, Boronic acid, B-benzo[b]thien-7-yl-, 7-benzothiophenylboronic acid, 7-benzothiophene boronic acid, benzothiophene-7-boronic acid, Benzo[b]thiophen-7-ylboronicacid