CAS 845872-49-3 appears in our catalog under these names: Benzothiophene-5-boronic acid, 98%, Benzothiophene-5-boronic acid, >95% (HPLC), Benzo[b]thiophen-5-ylboronic acid, 98%, 98%, 5-Benzothiopheneboronic acid, 97%, Benzo[b]thiophen-5-ylboronic acid, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-benzothiophen-5-ylboronic acid (CAS 845872-49-3) is a chemical compound with the molecular formula C8H7BO2S and a molecular weight of 178.02 g/mol. IUPAC name: 1-benzothiophen-5-ylboronic acid. InChIKey: LVRZWFSXTOTWTH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO2S |
|---|---|
| Molecular weight | 178.02 g/mol |
| IUPAC name | 1-benzothiophen-5-ylboronic acid |
| InChIKey | LVRZWFSXTOTWTH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC=C2)(O)O |
Computed by PubChem (NCBI)