CAS 62890-98-6 appears in our catalog under these names: 2,5–DiMethoxyphenylMagnesiuM broMide, 2,5-Dimethoxyphenylmagnesium bromide, 0.5M in 2-MeTHF . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100ml.
Magnesium;1,4-dimethoxybenzene-6-ide;bromide (CAS 62890-98-6) is a chemical compound with the molecular formula C8H9BrMgO2 and a molecular weight of 241.36 g/mol. IUPAC name: magnesium;1,4-dimethoxybenzene-6-ide;bromide. InChIKey: OGUMLBJCEMZKKU-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMgO2 |
|---|---|
| Molecular weight | 241.36 g/mol |
| IUPAC name | magnesium;1,4-dimethoxybenzene-6-ide;bromide |
| InChIKey | OGUMLBJCEMZKKU-UHFFFAOYSA-M |
| SMILES | COC1=C[C-]=C(C=C1)OC.[Mg+2].[Br-] |
Computed by PubChem (NCBI)