CAS 89980-69-8 appears in our catalog under these names: 3,4-Dimethoxyphenylmagnesium bromide, 0.5M in THF , 3,4-DIMETHOXYPHENYLMAGNESIUM BROMIDE, 0&. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1,2-dimethoxybenzene-5-ide;bromide (CAS 89980-69-8) is a chemical compound with the molecular formula C8H9BrMgO2 and a molecular weight of 241.36 g/mol. IUPAC name: magnesium;1,2-dimethoxybenzene-5-ide;bromide. InChIKey: QUXWTJDOUGUTNI-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMgO2 |
|---|---|
| Molecular weight | 241.36 g/mol |
| IUPAC name | magnesium;1,2-dimethoxybenzene-5-ide;bromide |
| InChIKey | QUXWTJDOUGUTNI-UHFFFAOYSA-M |
| SMILES | COC1=C(C=[C-]C=C1)OC.[Mg+2].[Br-] |
Computed by PubChem (NCBI)