CAS 629652-73-9 appears in our catalog under these names: 2-amino-6-chloro-3-hydroxybenzoic acid, >95% (HPLC), 2-Amino-6-chloro-3-hydroxybenzoic acid, 97%, 2-Amino-6-chloro-3-hydroxybenzoic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g.
2-amino-6-chloro-3-hydroxybenzoic acid (CAS 629652-73-9) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 2-amino-6-chloro-3-hydroxybenzoic acid. InChIKey: ZEGFVPKZTPJGRV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-amino-6-chloro-3-hydroxybenzoic acid |
| InChIKey | ZEGFVPKZTPJGRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)