CAS 629658-06-6 appears in our catalog under these names: 3–Chloro–4–Hydroxyphenylboronic Acid Pinacol Ester, 3-Chloro-4-hydroxyphenylboronic acid pinacol ester, 3-Chloro-4-hydroxyphenylboronic acid,pinacol ester, 95%, 95%, 2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 3-Chloro-4-hydroxyphenylboronic acid, pinacol ester, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 629658-06-6) is a chemical compound with the molecular formula C12H16BClO3 and a molecular weight of 254.52 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: HBKJZGOCTNRSHF-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO3 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | HBKJZGOCTNRSHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)