Products 6298-77-7

CAS 6298-77-7 is the registry number for 4-Morpholinecarboxylic Acid Isopropyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Propan-2-yl morpholine-4-carboxylate (CAS 6298-77-7) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: propan-2-yl morpholine-4-carboxylate. InChIKey: MEDWVADLUJVVPN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC namepropan-2-yl morpholine-4-carboxylate
InChIKeyMEDWVADLUJVVPN-UHFFFAOYSA-N
SMILESCC(C)OC(=O)N1CCOCC1

Computed by PubChem (NCBI)