CAS 630125-84-7 is the registry number for N-(4-(Bromomethyl)-3-(trifluoromethyl)phenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(bromomethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide (CAS 630125-84-7) is a chemical compound with the molecular formula C10H6BrF6NO and a molecular weight of 350.05 g/mol. IUPAC name: N-[4-(bromomethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide. InChIKey: GCIWCAMQJPRDKH-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF6NO |
|---|---|
| Molecular weight | 350.05 g/mol |
| IUPAC name | N-[4-(bromomethyl)-3-(trifluoromethyl)phenyl]-2,2,2-trifluoroacetamide |
| InChIKey | GCIWCAMQJPRDKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C(F)(F)F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)