CAS 99468-72-1 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-n-(bromoacetyl)aniline, 95%, 3,5-Bis(trifluoromethyl)-N-(bromoacetyl)aniline. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
N-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetamide (CAS 99468-72-1) is a chemical compound with the molecular formula C10H6BrF6NO and a molecular weight of 350.05 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetamide. InChIKey: DCCKYVKUIKRMPU-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF6NO |
|---|---|
| Molecular weight | 350.05 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-bromoacetamide |
| InChIKey | DCCKYVKUIKRMPU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)NC(=O)CBr)C(F)(F)F |
Computed by PubChem (NCBI)