CAS 630125-85-8 is the registry number for 2,2,2-Trifluoro-N-(4-methyl-3-(trifluoromethyl)phenyl)acetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (CAS 630125-85-8) is a chemical compound with the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. IUPAC name: 2,2,2-trifluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide. InChIKey: RFSRZWVCAVHHHS-UHFFFAOYSA-N.
| Molecular formula | C10H7F6NO |
|---|---|
| Molecular weight | 271.16 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| InChIKey | RFSRZWVCAVHHHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)