CAS 882747-78-6 is the registry number for 1-[2-Amino-4,6-bis(trifluoromethyl)phenyl]-1-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[2-amino-4,6-bis(trifluoromethyl)phenyl]ethanone (CAS 882747-78-6) is a chemical compound with the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. IUPAC name: 1-[2-amino-4,6-bis(trifluoromethyl)phenyl]ethanone. InChIKey: POBCVRAJLJFLIX-UHFFFAOYSA-N.
| Molecular formula | C10H7F6NO |
|---|---|
| Molecular weight | 271.16 g/mol |
| IUPAC name | 1-[2-amino-4,6-bis(trifluoromethyl)phenyl]ethanone |
| InChIKey | POBCVRAJLJFLIX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)