CAS 630422-98-9 appears in our catalog under these names: 7-Fluoro-6-methoxyisoquinolin-1(2h)-one, 95%, 7-Fluoro-6-methoxyisoquinolin-1(2H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
7-fluoro-6-methoxy-2H-isoquinolin-1-one (CAS 630422-98-9) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 7-fluoro-6-methoxy-2H-isoquinolin-1-one. InChIKey: MNYLLSMVYDGHNO-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 7-fluoro-6-methoxy-2H-isoquinolin-1-one |
| InChIKey | MNYLLSMVYDGHNO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CNC2=O)F |
Computed by PubChem (NCBI)