Products 63045-74-9
CAS 63045-74-9 is the registry number for 3-Hydroxy-2-nitroisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-2-nitropyridine-4-carboxylic acid (CAS 63045-74-9) is a chemical compound with the molecular formula C6H4N2O5 and a molecular weight of 184.11 g/mol. IUPAC name: 3-hydroxy-2-nitropyridine-4-carboxylic acid. InChIKey: BDPKNPUQDXKFHV-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O5 |
|---|---|
| Molecular weight | 184.11 g/mol |
| IUPAC name | 3-hydroxy-2-nitropyridine-4-carboxylic acid |
| InChIKey | BDPKNPUQDXKFHV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)