CAS 6854-07-5 appears in our catalog under these names: 5-Nitro-2-oxo-3-pyridinecarboxylic Acid 96%, 5-Nitro-2-oxo-3-pyridinecarboxylic Acid, 96%, 96%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
5-nitro-2-oxo-1H-pyridine-3-carboxylic acid (CAS 6854-07-5) is a chemical compound with the molecular formula C6H4N2O5 and a molecular weight of 184.11 g/mol. IUPAC name: 5-nitro-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: JVLVOEQOJYFQKR-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O5 |
|---|---|
| Molecular weight | 184.11 g/mol |
| IUPAC name | 5-nitro-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | JVLVOEQOJYFQKR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)