CAS 6308-02-7 is the registry number for 1,1,4,4-Tetramethyl-3,4-dihydronaphthalen-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,4,4-tetramethyl-3H-naphthalen-2-one (CAS 6308-02-7) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: 1,1,4,4-tetramethyl-3H-naphthalen-2-one. InChIKey: PMQHKFROIUJQAE-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 1,1,4,4-tetramethyl-3H-naphthalen-2-one |
| InChIKey | PMQHKFROIUJQAE-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C2=CC=CC=C21)(C)C)C |
Computed by PubChem (NCBI)