CAS 6309-36-0 is the registry number for Imidafenacin Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-diphenylpyrrolidin-2-one (CAS 6309-36-0) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: 3,3-diphenylpyrrolidin-2-one. InChIKey: JZDPAIGURSZOHS-UHFFFAOYSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 3,3-diphenylpyrrolidin-2-one |
| InChIKey | JZDPAIGURSZOHS-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C1(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)