Products 63195-79-9
CAS 63195-79-9 appears in our catalog under these names: 4-Hydroxy-3-nitrophenylethylamine nitrate, 95%, 4-Hydroxy-3-nitrophenylethylamine nitrate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
4-(2-aminoethyl)-2-nitrophenol;nitric acid (CAS 63195-79-9) is a chemical compound with the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. IUPAC name: 4-(2-aminoethyl)-2-nitrophenol;nitric acid. InChIKey: VPXUEKJUYGBXTM-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O6 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | 4-(2-aminoethyl)-2-nitrophenol;nitric acid |
| InChIKey | VPXUEKJUYGBXTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCN)[N+](=O)[O-])O.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)