CAS 83416-40-4 is the registry number for 1-alpha-D-Arabinofuranosyl-2-nitro-1H-imidazole. Offered by: TRC. Available pack sizes: 50mg.
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol (CAS 83416-40-4) is a chemical compound with the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. IUPAC name: (2R,3S,4S,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol. InChIKey: GEPYEWPQCQPUJN-JWXFUTCRSA-N.
| Molecular formula | C8H11N3O6 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol |
| InChIKey | GEPYEWPQCQPUJN-JWXFUTCRSA-N |
| SMILES | C1=CN(C(=N1)[N+](=O)[O-])[C@@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)