CAS 63216-52-4 appears in our catalog under these names: (1S,6R)-6-{[(tert-butoxy)carbonyl]amino}cyclohex-3-ene-1-carboxylic acid, 98%, Boc-1,2-cis-ACHeC-OH, Boc-cis-1,2-aminocyclohex-4-ene carboxylic acid, 99%. Offered by: Combi-blocks, Iris Biotech, Fluorochem. Available pack sizes: 5g, 1g.
(1S,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylic acid (CAS 63216-52-4) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (1S,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylic acid. InChIKey: FEPYBSDCOQXJAI-DTWKUNHWSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (1S,6R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-ene-1-carboxylic acid |
| InChIKey | FEPYBSDCOQXJAI-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC=CC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)