CAS 632327-18-5 appears in our catalog under these names: (R)-1-(3-Chlorophenyl)propane-1,3-diol, 98%, 98%, (R)-1-(3-Chlorophenyl)propane-1,3-diol, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
(1R)-1-(3-chlorophenyl)propane-1,3-diol (CAS 632327-18-5) is a chemical compound with the molecular formula C9H11ClO2 and a molecular weight of 186.63 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)propane-1,3-diol. InChIKey: VJGRFGFLZJIODS-SECBINFHSA-N.
| Molecular formula | C9H11ClO2 |
|---|---|
| Molecular weight | 186.63 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)propane-1,3-diol |
| InChIKey | VJGRFGFLZJIODS-SECBINFHSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CCO)O |
Computed by PubChem (NCBI)