CAS 6324-89-6 appears in our catalog under these names: 2,2-Dimethylbenzo[d][1,3]dioxol-5-amine, 95%, 2,2–Dimethylbenzo(d)(1,3)dioxol–5–amine, 2,2-Dimethylbenzo(d)(1,3)dioxol-5-amine, 2,2-Dimethylbenzo[d][1,3]dioxol-5-amine 95%, 2,2-Dimethylbenzo[d][1,3]dioxol-5-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g, 25g.
2,2-dimethyl-1,3-benzodioxol-5-amine (CAS 6324-89-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 2,2-dimethyl-1,3-benzodioxol-5-amine. InChIKey: IFQXAAQXRCQINZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 2,2-dimethyl-1,3-benzodioxol-5-amine |
| InChIKey | IFQXAAQXRCQINZ-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)N)C |
Computed by PubChem (NCBI)