CAS 6332-91-8 appears in our catalog under these names: 2,2'-[Thiocarbonylbis(sulfanediyl)]dipropionic Acid, >90.0%(GC)(T), 2-(1-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid, 90.0%, 90.0%. Offered by: TCI, Chemat. Available pack sizes: 1g.
2-(1-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid (CAS 6332-91-8) is a chemical compound with the molecular formula C7H10O4S3 and a molecular weight of 254.4 g/mol. IUPAC name: 2-(1-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid. InChIKey: WJSJKNCWBHCYME-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S3 |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 2-(1-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid |
| InChIKey | WJSJKNCWBHCYME-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC(=S)SC(C)C(=O)O |
Computed by PubChem (NCBI)