CAS 870451-09-5 appears in our catalog under these names: 2–(2–Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid, 3-[[[(1-Carboxyethyl)thio]carbonothioyl]thio]propanoic Acid, >95.0%(HPLC)(T), 2-[[(2-CARBOXYETHYL)SULFANYLTHIOCARBONY&, 3-((((1-Carboxyethyl)thio)carbonothioyl)thio)propanoic acid, 97%, 97%, 3-((((1-Carboxyethyl)thio)carbonothioyl)thio)propanoic acid, 97%,RG. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 100g, 25g.
2-(2-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid (CAS 870451-09-5) is a chemical compound with the molecular formula C7H10O4S3 and a molecular weight of 254.4 g/mol. IUPAC name: 2-(2-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid. InChIKey: IKWGMGMZWODWEO-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S3 |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 2-(2-carboxyethylsulfanylcarbothioylsulfanyl)propanoic acid |
| InChIKey | IKWGMGMZWODWEO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC(=S)SCCC(=O)O |
Computed by PubChem (NCBI)