Products 633305-21-2

CAS 633305-21-2 appears in our catalog under these names: 3-Chlorothiophene-2-sulfonyl chloride, 3-Chlorothiophene-2-sulfonyl chloride, 98%, 3-CHLOROTHIOPHENE-2-SULFONYL CHLORIDE, 95%, 3-Chlorothiophene-2-sulfonyl chloride, 95%, 95%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 5g, 1g, 100mg, 250mg.

3-chlorothiophene-2-sulfonyl chloride (CAS 633305-21-2) is a chemical compound with the molecular formula C4H2Cl2O2S2 and a molecular weight of 217.1 g/mol. IUPAC name: 3-chlorothiophene-2-sulfonyl chloride. InChIKey: UCQWIDZBMUWIKV-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2Cl2O2S2
Molecular weight217.1 g/mol
IUPAC name3-chlorothiophene-2-sulfonyl chloride
InChIKeyUCQWIDZBMUWIKV-UHFFFAOYSA-N
SMILESC1=CSC(=C1Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)