Products 937636-93-6

CAS 937636-93-6 appears in our catalog under these names: 4-Chlorothiophene-3-sulfonyl chloride, 95%, 4-Chlorothiophene-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

4-chlorothiophene-3-sulfonyl chloride (CAS 937636-93-6) is a chemical compound with the molecular formula C4H2Cl2O2S2 and a molecular weight of 217.1 g/mol. IUPAC name: 4-chlorothiophene-3-sulfonyl chloride. InChIKey: RHKPSMIYICGGOH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2Cl2O2S2
Molecular weight217.1 g/mol
IUPAC name4-chlorothiophene-3-sulfonyl chloride
InChIKeyRHKPSMIYICGGOH-UHFFFAOYSA-N
SMILESC1=C(C(=CS1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)