CAS 6334-37-8 is the registry number for 1–Chloro–4–iodonaphthalene. Offered by: GLPBio. Available pack sizes: 100mg.
1-chloro-4-iodonaphthalene (CAS 6334-37-8) is a chemical compound with the molecular formula C10H6ClI and a molecular weight of 288.51 g/mol. IUPAC name: 1-chloro-4-iodonaphthalene. InChIKey: UFDGEFUTYSMTPD-UHFFFAOYSA-N.
| Molecular formula | C10H6ClI |
|---|---|
| Molecular weight | 288.51 g/mol |
| IUPAC name | 1-chloro-4-iodonaphthalene |
| InChIKey | UFDGEFUTYSMTPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2I)Cl |
Computed by PubChem (NCBI)