CAS 63406-18-8 is the registry number for Methyl 2,2-Dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate-'cis major'. Offered by: TRC. Available pack sizes: 100mg.
Methyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (CAS 63406-18-8) is a chemical compound with the molecular formula C9H13Cl3O2 and a molecular weight of 259.6 g/mol. IUPAC name: methyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate. InChIKey: YCUDCHKDRGFXPX-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl3O2 |
|---|---|
| Molecular weight | 259.6 g/mol |
| IUPAC name | methyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| InChIKey | YCUDCHKDRGFXPX-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)OC)CC(Cl)(Cl)Cl)C |
Computed by PubChem (NCBI)