CAS 64879-04-5 is the registry number for Cis-Methyl-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate. Offered by: TRC. Available pack sizes: 100mg.
Trans-methyl (1R,3S)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (CAS 64879-04-5) is a chemical compound with the molecular formula C9H13Cl3O2 and a molecular weight of 259.6 g/mol. IUPAC name: trans-methyl (1R,3S)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate. InChIKey: YCUDCHKDRGFXPX-WDSKDSINSA-N.
| Molecular formula | C9H13Cl3O2 |
|---|---|
| Molecular weight | 259.6 g/mol |
| IUPAC name | trans-methyl (1R,3S)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| InChIKey | YCUDCHKDRGFXPX-WDSKDSINSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)OC)CC(Cl)(Cl)Cl)C |
Computed by PubChem (NCBI)