Products 63419-77-2
CAS 63419-77-2 appears in our catalog under these names: Cyanoguanidine-15N4, >95% (HPLC), Cyanoguanidine-15N4. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 25 mg.
2-(15N)cyanoguanidine (CAS 63419-77-2) is a chemical compound with the molecular formula C2H4N4 and a molecular weight of 88.05 g/mol. IUPAC name: 2-(15N)cyanoguanidine. InChIKey: QGBSISYHAICWAH-PQVJJBODSA-N.
| Molecular formula | C2H4N4 |
|---|---|
| Molecular weight | 88.05 g/mol |
| IUPAC name | 2-(15N)cyanoguanidine |
| InChIKey | QGBSISYHAICWAH-PQVJJBODSA-N |
| SMILES | C(#[15N])[15N]=C([15NH2])[15NH2] |
Computed by PubChem (NCBI)